EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14 |
| Net Charge | 0 |
| Average Mass | 134.222 |
| Monoisotopic Mass | 134.10955 |
| SMILES | [H]C(=CC([H])=C(C)C=C)C(=C)C |
| InChI | InChI=1S/C10H14/c1-5-10(4)8-6-7-9(2)3/h5-8H,1-2H2,3-4H3 |
| InChIKey | HPZWSJQQCJZBBG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dimethyl-1,3,5,7-octatetraene (CHEBI:87600) has role metabolite (CHEBI:25212) |
| 2,6-dimethyl-1,3,5,7-octatetraene (CHEBI:87600) is a alkatetraene (CHEBI:37835) |
| IUPAC Name |
|---|
| 2,6-dimethylocta-1,3,5,7-tetraene |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1735995 | Reaxys |