EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7NO |
| Net Charge | 0 |
| Average Mass | 97.117 |
| Monoisotopic Mass | 97.05276 |
| SMILES | CC(=O)C(C)C#N |
| InChI | InChI=1S/C5H7NO/c1-4(3-6)5(2)7/h4H,1-2H3 |
| InChIKey | AMQCWPDDXYOEER-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-cyano-2-butanone (CHEBI:87599) has functional parent butan-2-one (CHEBI:28398) |
| 3-cyano-2-butanone (CHEBI:87599) has role metabolite (CHEBI:25212) |
| 3-cyano-2-butanone (CHEBI:87599) is a methyl ketone (CHEBI:51867) |
| 3-cyano-2-butanone (CHEBI:87599) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| 2-methyl-3-oxobutanenitrile |
| Synonym | Source |
|---|---|
| 2-methyl-3-keto-butyronitrile | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:878249 | Reaxys |