EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O2 |
| Net Charge | 0 |
| Average Mass | 178.231 |
| Monoisotopic Mass | 178.09938 |
| SMILES | CC(c1ccccc1)C1OCCO1 |
| InChI | InChI=1S/C11H14O2/c1-9(11-12-7-8-13-11)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3 |
| InChIKey | SATZAQAJSHXNSJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(1-phenylethyl)-1,3-dioxolane (CHEBI:87596) has parent hydride 1,3-dioxolane (CHEBI:87597) |
| 2-(1-phenylethyl)-1,3-dioxolane (CHEBI:87596) has role metabolite (CHEBI:25212) |
| 2-(1-phenylethyl)-1,3-dioxolane (CHEBI:87596) is a benzenes (CHEBI:22712) |
| 2-(1-phenylethyl)-1,3-dioxolane (CHEBI:87596) is a cyclic acetal (CHEBI:59770) |
| 2-(1-phenylethyl)-1,3-dioxolane (CHEBI:87596) is a dioxolane (CHEBI:39430) |
| IUPAC Name |
|---|
| 2-(1-phenylethyl)-1,3-dioxolane |
| Synonym | Source |
|---|---|
| 2-phenylpropanal ethylene acetal | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:124019 | Reaxys |
| CAS:4362-22-5 | ChemIDplus |