EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18O |
| Net Charge | 0 |
| Average Mass | 142.242 |
| Monoisotopic Mass | 142.13577 |
| SMILES | [H]C(CCC(C)CO)=C(C)C |
| InChI | InChI=1S/C9H18O/c1-8(2)5-4-6-9(3)7-10/h5,9-10H,4,6-7H2,1-3H3 |
| InChIKey | WFZFXUZFKAOTRR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dimethyl-5-hepten-1-ol (CHEBI:87594) has role metabolite (CHEBI:25212) |
| 2,6-dimethyl-5-hepten-1-ol (CHEBI:87594) is a olefinic compound (CHEBI:78840) |
| 2,6-dimethyl-5-hepten-1-ol (CHEBI:87594) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 2,6-dimethylhept-5-en-1-ol |
| Synonym | Source |
|---|---|
| Melonol | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1742156 | Reaxys |
| CAS:4234-93-9 | NIST Chemistry WebBook |