EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87587 - 3-methylsuccinic anhydride
| Formula | C5H6O3 |
| Net Charge | 0 |
| Average Mass | 114.100 |
| Monoisotopic Mass | 114.03169 |
| SMILES | CC1CC(=O)OC1=O |
| InChI | InChI=1S/C5H6O3/c1-3-2-4(6)8-5(3)7/h3H,2H2,1H3 |
| InChIKey | DFATXMYLKPCSCX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylsuccinic anhydride (CHEBI:87587) has functional parent succinic anhydride (CHEBI:36595) |
| 3-methylsuccinic anhydride (CHEBI:87587) has role metabolite (CHEBI:25212) |
| 3-methylsuccinic anhydride (CHEBI:87587) is a cyclic dicarboxylic anhydride (CHEBI:36609) |
| 3-methylsuccinic anhydride (CHEBI:87587) is a tetrahydrofurandione (CHEBI:47022) |
| IUPAC Name |
|---|
| 3-methyloxolane-2,5-dione |
| Synonyms | Source |
|---|---|
| Pyrotartaric anhydride | NIST Chemistry WebBook |
| methylsuccinic anhydride | ChEBI |