EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O |
| Net Charge | 0 |
| Average Mass | 128.215 |
| Monoisotopic Mass | 128.12012 |
| SMILES | C=CCCCCC(C)O |
| InChI | InChI=1S/C8H16O/c1-3-4-5-6-7-8(2)9/h3,8-9H,1,4-7H2,2H3 |
| InChIKey | HSHUHVOEMVTVRS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-octen-2-ol (CHEBI:87586) has role metabolite (CHEBI:25212) |
| 7-octen-2-ol (CHEBI:87586) is a olefinic compound (CHEBI:78840) |
| 7-octen-2-ol (CHEBI:87586) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| oct-7-en-2-ol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0037181 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2070715 | Reaxys |
| CAS:39546-75-3 | NIST Chemistry WebBook |