EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O5 |
| Net Charge | 0 |
| Average Mass | 240.255 |
| Monoisotopic Mass | 240.09977 |
| SMILES | CCCCCCC1=C(CC(=O)O)C(=O)OC1=O |
| InChI | InChI=1S/C12H16O5/c1-2-3-4-5-6-8-9(7-10(13)14)12(16)17-11(8)15/h2-7H2,1H3,(H,13,14) |
| InChIKey | UMHSTRUKUXAWBA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-hexyl-2,5-dioxo-2,5-dihydro-3-furanyl)acetic acid (CHEBI:87585) has role metabolite (CHEBI:25212) |
| (4-hexyl-2,5-dioxo-2,5-dihydro-3-furanyl)acetic acid (CHEBI:87585) is a cyclic dicarboxylic anhydride (CHEBI:36609) |
| (4-hexyl-2,5-dioxo-2,5-dihydro-3-furanyl)acetic acid (CHEBI:87585) is a dioxo monocarboxylic acid (CHEBI:35951) |
| (4-hexyl-2,5-dioxo-2,5-dihydro-3-furanyl)acetic acid (CHEBI:87585) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| (4-hexyl-2,5-dioxo-2,5-dihydrofuran-3-yl)acetic acid |
| Synonym | Source |
|---|---|
| 2-carboxymethyl-3-hexylmaleic acid anhydride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1430092 | Reaxys |