EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87574 - (Z)-β-ocimene
| Formula | C10H16 |
| Net Charge | 0 |
| Average Mass | 136.238 |
| Monoisotopic Mass | 136.12520 |
| SMILES | C=C/C(C)=C\CC=C(C)C |
| InChI | InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7-8H,1,6H2,2-4H3/b10-8- |
| InChIKey | IHPKGUQCSIINRJ-NTMALXAHSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-β-ocimene (CHEBI:87574) has role plant metabolite (CHEBI:76924) |
| (Z)-β-ocimene (CHEBI:87574) is a β-ocimene (CHEBI:10436) |
| IUPAC Name |
|---|
| (3Z)-3,7-dimethylocta-1,3,6-triene |
| Synonyms | Source |
|---|---|
| β-cis-ocimene | NIST Chemistry WebBook |
| cis-3,7-dimethyl-1,3,6-octatriene | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (Z)-β-ocimene | UniProt |
| Citations |
|---|