EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | [H]C(=O)C(C)C1CC=C(C)CC1 |
| InChI | InChI=1S/C10H16O/c1-8-3-5-10(6-4-8)9(2)7-11/h3,7,9-10H,4-6H2,1-2H3 |
| InChIKey | UMEJBWOWZDRULR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-p-menth-1-ene-9-al (CHEBI:87568) has parent hydride p-menthane (CHEBI:25826) |
| 1-p-menth-1-ene-9-al (CHEBI:87568) has role metabolite (CHEBI:25212) |
| 1-p-menth-1-ene-9-al (CHEBI:87568) is a aldehyde (CHEBI:17478) |
| 1-p-menth-1-ene-9-al (CHEBI:87568) is a monoterpenoid (CHEBI:25409) |
| IUPAC Name |
|---|
| 2-(4-methylcyclohex-3-en-1-yl)propanal |
| Synonym | Source |
|---|---|
| α,4-dimethyl-3-cyclohexene-1-acetaldehyde | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2206739 | Reaxys |
| CAS:29548-14-9 | ChemIDplus |
| CAS:29548-14-9 | NIST Chemistry WebBook |
| Citations |
|---|