EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O |
| Net Charge | 0 |
| Average Mass | 112.172 |
| Monoisotopic Mass | 112.08882 |
| SMILES | C=CC(=O)CCCC |
| InChI | InChI=1S/C7H12O/c1-3-5-6-7(8)4-2/h4H,2-3,5-6H2,1H3 |
| InChIKey | OYLCUJRJCUXQBQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Postia leucomallella (ncbitaxon:1046361) | fruit body (BTO:0000487) | PubMed (16356517) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-hepten-3-one (CHEBI:87567) has role fungal metabolite (CHEBI:76946) |
| 1-hepten-3-one (CHEBI:87567) is a enone (CHEBI:51689) |
| IUPAC Name |
|---|
| hept-1-en-3-one |
| Synonyms | Source |
|---|---|
| vinyl butyl ketone | ChEBI |
| n-butylacrolein | ChEBI |
| Citations |
|---|