EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O2 |
| Net Charge | 0 |
| Average Mass | 172.268 |
| Monoisotopic Mass | 172.14633 |
| SMILES | CCCCCCOC(=O)CCC |
| InChI | InChI=1S/C10H20O2/c1-3-5-6-7-9-12-10(11)8-4-2/h3-9H2,1-2H3 |
| InChIKey | XAPCMTMQBXLDBB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexyl butyrate (CHEBI:87559) has functional parent butyric acid (CHEBI:30772) |
| hexyl butyrate (CHEBI:87559) has functional parent hexan-1-ol (CHEBI:87393) |
| hexyl butyrate (CHEBI:87559) has role animal metabolite (CHEBI:75767) |
| hexyl butyrate (CHEBI:87559) is a fatty acid ester (CHEBI:35748) |
| IUPAC Name |
|---|
| hexyl butanoate |
| UniProt Name | Source |
|---|---|
| hexyl butanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033620 | HMDB |
| LMFA07010419 | LIPID MAPS |
| Citations |
|---|