EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87556 - ε-metofluthrin
| Formula | C18H20F4O3 |
| Net Charge | 0 |
| Average Mass | 360.347 |
| Monoisotopic Mass | 360.13486 |
| SMILES | C/C=C\[C@@H]1[C@@H](C(=O)OCc2c(F)c(F)c(COC)c(F)c2F)C1(C)C |
| InChI | InChI=1S/C18H20F4O3/c1-5-6-11-12(18(11,2)3)17(23)25-8-10-15(21)13(19)9(7-24-4)14(20)16(10)22/h5-6,11-12H,7-8H2,1-4H3/b6-5-/t11-,12+/m1/s1 |
| InChIKey | KVIZNNVXXNFLMU-DUVUQDDDSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ε-metofluthrin (CHEBI:87556) has role agrochemical (CHEBI:33286) |
| ε-metofluthrin (CHEBI:87556) has role pyrethroid ester insecticide (CHEBI:39116) |
| ε-metofluthrin (CHEBI:87556) is a carboxylic ester (CHEBI:33308) |
| ε-metofluthrin (CHEBI:87556) is a cyclopropanes (CHEBI:51454) |
| ε-metofluthrin (CHEBI:87556) is a ether (CHEBI:25698) |
| ε-metofluthrin (CHEBI:87556) is a organofluorine insecticide (CHEBI:38804) |
| ε-metofluthrin (CHEBI:87556) is a tetrafluorobenzene (CHEBI:85066) |
| IUPAC Name |
|---|
| [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (1R,3R)-2,2-dimethyl-3-[(1Z)-prop-1-en-1-yl]cyclopropane-1-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| epsilon-metofluthrin | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10380359 | Reaxys |
| CAS:240494-71-7 | Alan Wood's Pesticides |