EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20OS |
| Net Charge | 0 |
| Average Mass | 188.336 |
| Monoisotopic Mass | 188.12349 |
| SMILES | CCCCCCCCSC(C)=O |
| InChI | InChI=1S/C10H20OS/c1-3-4-5-6-7-8-9-12-10(2)11/h3-9H2,1-2H3 |
| InChIKey | NQMNVUDCUZKJRL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-octyl ethanethioate (CHEBI:87547) has role metabolite (CHEBI:25212) |
| S-octyl ethanethioate (CHEBI:87547) is a thioacetate ester (CHEBI:52477) |
| IUPAC Name |
|---|
| S-octyl ethanethioate |
| Synonyms | Source |
|---|---|
| 1-acetylthiooctane | ChEBI |
| S-octyl thioacetate | ChEBI |
| thioacetic acid S-octyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1754773 | Reaxys |