EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4N6 |
| Net Charge | 0 |
| Average Mass | 100.085 |
| Monoisotopic Mass | 100.04974 |
| SMILES | Nc1nnnn1N |
| InChI | InChI=1S/CH4N6/c2-1-4-5-6-7(1)3/h3H2,(H2,2,4,6) |
| InChIKey | XMGWNAIPGOPSNX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,5-diaminotetrazole (CHEBI:87539) has parent hydride 1H-tetrazole (CHEBI:33193) |
| 1,5-diaminotetrazole (CHEBI:87539) has role metabolite (CHEBI:25212) |
| 1,5-diaminotetrazole (CHEBI:87539) is a aromatic amine (CHEBI:33860) |
| 1,5-diaminotetrazole (CHEBI:87539) is a tetrazoles (CHEBI:35689) |
| IUPAC Name |
|---|
| 1H-tetrazole-1,5-diamine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:123364 | Reaxys |