EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18O2 |
| Net Charge | 0 |
| Average Mass | 158.241 |
| Monoisotopic Mass | 158.13068 |
| SMILES | CC(C)CCOC(=O)C(C)C |
| InChI | InChI=1S/C9H18O2/c1-7(2)5-6-11-9(10)8(3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | VFTGLSWXJMRZNB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isoamyl isobutyrate (CHEBI:87537) has functional parent isoamylol (CHEBI:15837) |
| isoamyl isobutyrate (CHEBI:87537) has functional parent isobutyric acid (CHEBI:16135) |
| isoamyl isobutyrate (CHEBI:87537) has role metabolite (CHEBI:25212) |
| isoamyl isobutyrate (CHEBI:87537) is a fatty acid ester (CHEBI:35748) |
| IUPAC Name |
|---|
| 3-methylbutyl 2-methylpropanoate |
| Synonyms | Source |
|---|---|
| isopentyl isobutyrate | ChemIDplus |
| isopentyl 2-methylpropanoate | ChemIDplus |
| isoamyl 2-methylpropanoate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036234 | HMDB |
| Citations |
|---|