EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14 |
| Net Charge | 0 |
| Average Mass | 110.200 |
| Monoisotopic Mass | 110.10955 |
| SMILES | C=C(C)C(C)/C=C/C |
| InChI | InChI=1S/C8H14/c1-5-6-8(4)7(2)3/h5-6,8H,2H2,1,3-4H3/b6-5+ |
| InChIKey | QGDVKFLWAVKNAA-AATRIKPKSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4E)-2,3-dimethylhexa-1,4-diene (CHEBI:87530) has role metabolite (CHEBI:25212) |
| (4E)-2,3-dimethylhexa-1,4-diene (CHEBI:87530) is a alkadiene (CHEBI:33646) |
| IUPAC Name |
|---|
| (4E)-2,3-dimethylhexa-1,4-diene |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2203085 | Reaxys |
| CAS:18669-52-8 | ChemIDplus |