EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24O2 |
| Net Charge | 0 |
| Average Mass | 200.322 |
| Monoisotopic Mass | 200.17763 |
| SMILES | CCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C12H24O2/c1-3-4-5-6-7-8-9-10-11-12(13)14-2/h3-11H2,1-2H3 |
| InChIKey | XPQPWPZFBULGKT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl undecanoate (CHEBI:87527) has functional parent undecanoic acid (CHEBI:32368) |
| methyl undecanoate (CHEBI:87527) has role metabolite (CHEBI:25212) |
| methyl undecanoate (CHEBI:87527) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl undecanoate |
| Synonyms | Source |
|---|---|
| methyl undecylenate | ChEBI |
| undecanoic acid methyl ester | ChEBI |
| Citations |
|---|