EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14O2 |
| Net Charge | 0 |
| Average Mass | 154.209 |
| Monoisotopic Mass | 154.09938 |
| SMILES | C=CCC1(C(=O)OCC)CC1 |
| InChI | InChI=1S/C9H14O2/c1-3-5-9(6-7-9)8(10)11-4-2/h3H,1,4-7H2,2H3 |
| InChIKey | CDDXFMWEYMJTPK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 1-allylcyclopropanecarboxylate (CHEBI:87524) has role metabolite (CHEBI:25212) |
| ethyl 1-allylcyclopropanecarboxylate (CHEBI:87524) is a carboxylic ester (CHEBI:33308) |
| ethyl 1-allylcyclopropanecarboxylate (CHEBI:87524) is a cyclopropanes (CHEBI:51454) |
| IUPAC Name |
|---|
| ethyl 1-(prop-2-en-1-yl)cyclopropane-1-carboxylate |
| Synonym | Source |
|---|---|
| 2-propenyl-cyclopropanecarboxylic acid ethyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10246400 | Reaxys |