EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O10P2 |
| Net Charge | -2 |
| Average Mass | 425.187 |
| Monoisotopic Mass | 425.01486 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H15N5O10P2/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(24-10)1-23-27(21,22)25-26(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H2,11,12,13)(H2,18,19,20)/p-2/t4-,6-,7-,10-/m1/s1 |
| InChIKey | XTWYTFMLZFPYCI-KQYNXXCUSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ADP(2−) (CHEBI:87518) is a organophosphate oxoanion (CHEBI:58945) |
| ADP(2−) (CHEBI:87518) is conjugate acid of ADP(3−) (CHEBI:456216) |
| ADP(2−) (CHEBI:87518) is conjugate base of ADP (CHEBI:16761) |
| Incoming Relation(s) |
| MgADP (CHEBI:87194) has part ADP(2−) (CHEBI:87518) |
| ADP (CHEBI:16761) is conjugate acid of ADP(2−) (CHEBI:87518) |
| ADP(3−) (CHEBI:456216) is conjugate base of ADP(2−) (CHEBI:87518) |
| IUPAC Name |
|---|
| 5'-O-{[(hydroxyphosphinato)oxy]phosphinato}adenosine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7558006 | Reaxys |