EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16 |
| Net Charge | 0 |
| Average Mass | 112.216 |
| Monoisotopic Mass | 112.12520 |
| SMILES | C=CCC(C)C(C)C |
| InChI | InChI=1S/C8H16/c1-5-6-8(4)7(2)3/h5,7-8H,1,6H2,2-4H3 |
| InChIKey | UFWIBUBEFUNVNI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-dimethyl-1-hexene (CHEBI:87517) has parent hydride 1-hexene (CHEBI:24579) |
| 4,5-dimethyl-1-hexene (CHEBI:87517) has role metabolite (CHEBI:25212) |
| 4,5-dimethyl-1-hexene (CHEBI:87517) is a alkene (CHEBI:32878) |
| IUPAC Name |
|---|
| 4,5-dimethylhex-1-ene |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1697263 | Reaxys |
| CAS:16106-59-5 | ChemIDplus |
| CAS:16106-59-5 | NIST Chemistry WebBook |