EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8OS |
| Net Charge | 0 |
| Average Mass | 116.185 |
| Monoisotopic Mass | 116.02959 |
| SMILES | CC1SCCC1=O |
| InChI | InChI=1S/C5H8OS/c1-4-5(6)2-3-7-4/h4H,2-3H2,1H3 |
| InChIKey | YMZZPMVKABUEBL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylthiolan-3-one (CHEBI:87506) has parent hydride tetrahydrothiophene (CHEBI:48458) |
| 2-methylthiolan-3-one (CHEBI:87506) has role flavouring agent (CHEBI:35617) |
| 2-methylthiolan-3-one (CHEBI:87506) has role metabolite (CHEBI:25212) |
| 2-methylthiolan-3-one (CHEBI:87506) is a cyclic ketone (CHEBI:3992) |
| 2-methylthiolan-3-one (CHEBI:87506) is a tetrahydrothiophenes (CHEBI:48224) |
| IUPAC Name |
|---|
| 2-methylthiolan-3-one |
| Synonym | Source |
|---|---|
| 2-methyltetrahydrothiophen-3-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0038556 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:106443 | Reaxys |
| CAS:74015-70-6 | ChemIDplus |
| CAS:74015-70-6 | NIST Chemistry WebBook |
| Citations |
|---|