EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O2S |
| Net Charge | 0 |
| Average Mass | 148.227 |
| Monoisotopic Mass | 148.05580 |
| SMILES | CCOC(=O)CCSC |
| InChI | InChI=1S/C6H12O2S/c1-3-8-6(7)4-5-9-2/h3-5H2,1-2H3 |
| InChIKey | YSNWHRKJEKWJNY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ananas comosus (ncbitaxon:4615) | - | PubMed (22837701) | |
| Cucumis melo var. cantalupo (ncbitaxon:3658) | - | PubMed (15237961) | |
| Fragaria x ananassa (ncbitaxon:3747) | - | PubMed (21280634) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 3-(methylthio)propionate (CHEBI:87503) has functional parent 3-(methylthio)propionic acid (CHEBI:1438) |
| ethyl 3-(methylthio)propionate (CHEBI:87503) has role plant metabolite (CHEBI:76924) |
| ethyl 3-(methylthio)propionate (CHEBI:87503) is a carboxylic ester (CHEBI:33308) |
| ethyl 3-(methylthio)propionate (CHEBI:87503) is a methyl sulfide (CHEBI:86315) |
| IUPAC Name |
|---|
| ethyl 3-(methylsulfanyl)propanoate |
| Synonyms | Source |
|---|---|
| 3-(methylthio)propanoic acid ethyl ester | ChEBI |
| Ethyl 3-(methylmercapto)propionate | ChemIDplus |
| Ethyl 3-(methylthio)propanoate | HMDB |
| ethyl 3-(methylthio)propionate | ChEBI |
| Ethyl methyl mercaptopropionate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| FDB020145 | FooDB |
| HMDB0040413 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1748688 | Reaxys |
| CAS:13327-56-5 | ChemIDplus |
| CAS:13327-56-5 | NIST Chemistry WebBook |
| Citations |
|---|