EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13N |
| Net Charge | 0 |
| Average Mass | 99.177 |
| Monoisotopic Mass | 99.10480 |
| SMILES | CC(C)=CCCN |
| InChI | InChI=1S/C6H13N/c1-6(2)4-3-5-7/h4H,3,5,7H2,1-2H3 |
| InChIKey | KGNHJDRDIDXUHY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methyl-3-penten-1-amine (CHEBI:87502) has role metabolite (CHEBI:25212) |
| 4-methyl-3-penten-1-amine (CHEBI:87502) is a alkylamine (CHEBI:13759) |
| 4-methyl-3-penten-1-amine (CHEBI:87502) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 4-methylpent-3-en-1-amine |
| Synonym | Source |
|---|---|
| 1-amino-4-methyl-3-pentene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4361412 | Reaxys |