EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22O2 |
| Net Charge | 0 |
| Average Mass | 186.295 |
| Monoisotopic Mass | 186.16198 |
| SMILES | CCCCCCCCC(=O)OCC |
| InChI | InChI=1S/C11H22O2/c1-3-5-6-7-8-9-10-11(12)13-4-2/h3-10H2,1-2H3 |
| InChIKey | BYEVBITUADOIGY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl nonanoate (CHEBI:87501) has functional parent nonanoic acid (CHEBI:29019) |
| ethyl nonanoate (CHEBI:87501) has role metabolite (CHEBI:25212) |
| ethyl nonanoate (CHEBI:87501) is a fatty acid ethyl ester (CHEBI:78206) |
| IUPAC Name |
|---|
| ethyl nonanoate |
| Synonyms | Source |
|---|---|
| pelargonic acid ethyl ester | ChEBI |
| nonanoic acid ethyl ester | ChEBI |
| ethyl pelargonate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0040193 | HMDB |
| LMFA07010878 | LIPID MAPS |
| Citations |
|---|