EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O2 |
| Net Charge | 0 |
| Average Mass | 172.268 |
| Monoisotopic Mass | 172.14633 |
| SMILES | CCCCCCCCOC(C)=O |
| InChI | InChI=1S/C10H20O2/c1-3-4-5-6-7-8-9-12-10(2)11/h3-9H2,1-2H3 |
| InChIKey | YLYBTZIQSIBWLI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Heracleum sphondylium subsp. ternatum (ncbitaxon:542667) | - | PubMed (24697288) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octyl acetate (CHEBI:87495) has functional parent octan-1-ol (CHEBI:16188) |
| octyl acetate (CHEBI:87495) has role plant metabolite (CHEBI:76924) |
| octyl acetate (CHEBI:87495) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| octyl acetate |
| Synonyms | Source |
|---|---|
| Caprylyl acetate | ChemIDplus |
| Octyl ethanoate | ChemIDplus |
| n-Octanyl acetate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| octyl acetate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMFA07010197 | LIPID MAPS |
| Octyl_acetate | Wikipedia |
| HMDB0038602 | HMDB |
| Citations |
|---|