EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87490 - hexyl octanoate
| Formula | C14H28O2 |
| Net Charge | 0 |
| Average Mass | 228.376 |
| Monoisotopic Mass | 228.20893 |
| SMILES | CCCCCCCC(=O)OCCCCCC |
| InChI | InChI=1S/C14H28O2/c1-3-5-7-9-10-12-14(15)16-13-11-8-6-4-2/h3-13H2,1-2H3 |
| InChIKey | PBGWNXWNCSSXCO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexyl octanoate (CHEBI:87490) has functional parent hexan-1-ol (CHEBI:87393) |
| hexyl octanoate (CHEBI:87490) has role plant metabolite (CHEBI:76924) |
| hexyl octanoate (CHEBI:87490) is a octanoate ester (CHEBI:87657) |
| IUPAC Name |
|---|
| hexyl octanoate |
| Synonyms | Source |
|---|---|
| Hexyl caprylate | ChemIDplus |
| Hexyl octylate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| hexyl octanoate | UniProt |
| Citations |
|---|