EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H42N7O18P3S |
| Net Charge | 0 |
| Average Mass | 853.631 |
| Monoisotopic Mass | 853.15199 |
| SMILES | CC[C@@H](O)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C25H42N7O18P3S/c1-4-13(33)24(38)54-8-7-27-15(34)5-6-28-22(37)19(36)25(2,3)10-47-53(44,45)50-52(42,43)46-9-14-18(49-51(39,40)41)17(35)23(48-14)32-12-31-16-20(26)29-11-30-21(16)32/h11-14,17-19,23,33,35-36H,4-10H2,1-3H3,(H,27,34)(H,28,37)(H,42,43)(H,44,45)(H2,26,29,30)(H2,39,40,41)/t13-,14-,17-,18-,19+,23-/m1/s1 |
| InChIKey | AIYBLGFBHQLGMH-XGVFZYDCSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-2-hydroxybutanoyl-CoA (CHEBI:87475) is a 2-hydroxybutanoyl-CoA (CHEBI:139303) |
| (R)-2-hydroxybutanoyl-CoA (CHEBI:87475) is conjugate acid of (R)-2-hydroxybutanoyl-CoA(4−) (CHEBI:87474) |
| Incoming Relation(s) |
| (R)-2-hydroxybutanoyl-CoA(4−) (CHEBI:87474) is conjugate base of (R)-2-hydroxybutanoyl-CoA (CHEBI:87475) |
| Synonym | Source |
|---|---|
| (R)-2-hydroxybutyryl-CoA | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| CPD-15376 | MetaCyc |
| Citations |
|---|