EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13N3O8S2.2Na |
| Net Charge | 0 |
| Average Mass | 509.429 |
| Monoisotopic Mass | 508.99394 |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])c(N=Nc3ccccc3)c(O)c12.[Na+].[Na+] |
| InChI | InChI=1S/C18H15N3O8S2.2Na/c1-10(22)19-14-9-13(30(24,25)26)7-11-8-15(31(27,28)29)17(18(23)16(11)14)21-20-12-5-3-2-4-6-12;;/h2-9,23H,1H3,(H,19,22)(H,24,25,26)(H,27,28,29);;/q;2*+1/p-2 |
| InChIKey | WXLFIFHRGFOVCD-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azophloxine (CHEBI:87464) has part 5-acetamido-4-hydroxy-3-(phenyldiazenyl)naphthalene-2,7-disulfonate (CHEBI:87466) |
| azophloxine (CHEBI:87464) has role histological dye (CHEBI:77178) |
| azophloxine (CHEBI:87464) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 5-acetamido-4-hydroxy-3-(phenyldiazenyl)naphthalene-2,7-disulfonate |
| Synonyms | Source |
|---|---|
| acid red 1 | ChEBI |
| amidonaphthol red G | ChEBI |
| C.I. 18050 | ChEBI |
| C.I. Acid Red 1 | ChemIDplus |
| C.I. Acid Red 1, disodium salt | ChemIDplus |
| C. I. Food Red 10 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4121767 | Reaxys |
| CAS:3734-67-6 | ChemIDplus |
| Citations |
|---|