EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N4O2 |
| Net Charge | 0 |
| Average Mass | 312.373 |
| Monoisotopic Mass | 312.15863 |
| SMILES | N=C(N)c1ccc(OCCCOc2ccc(C(=N)N)cc2)cc1 |
| InChI | InChI=1S/C17H20N4O2/c18-16(19)12-2-6-14(7-3-12)22-10-1-11-23-15-8-4-13(5-9-15)17(20)21/h2-9H,1,10-11H2,(H3,18,19)(H3,20,21) |
| InChIKey | WTFXJFJYEJZMFO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| propamidine (CHEBI:87462) has functional parent propane-1,3-diol (CHEBI:16109) |
| propamidine (CHEBI:87462) has role antimicrobial agent (CHEBI:33281) |
| propamidine (CHEBI:87462) has role antiseptic drug (CHEBI:48218) |
| propamidine (CHEBI:87462) is a aromatic ether (CHEBI:35618) |
| propamidine (CHEBI:87462) is a guanidines (CHEBI:24436) |
| propamidine (CHEBI:87462) is a polyether (CHEBI:46774) |
| propamidine (CHEBI:87462) is conjugate base of propamidine(2+) (CHEBI:87463) |
| Incoming Relation(s) |
| propamidine(2+) (CHEBI:87463) is conjugate acid of propamidine (CHEBI:87462) |
| IUPAC Name |
|---|
| 4,4'-[propane-1,3-diylbis(oxy)]di(benzene-1-carboximidamide) |
| INNs | Source |
|---|---|
| propamidina | ChemIDplus |
| propamidine | ChemIDplus |
| propamidine | KEGG DRUG |
| propamidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4,4'-(1,3-Propanediylbis(oxy))bis-benzenecarboximidamide | ChemIDplus |
| 4,4'-(Trimethylenedioxy)dibenzamidine | ChemIDplus |
| Citations |
|---|