EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N2O |
| Net Charge | +1 |
| Average Mass | 177.227 |
| Monoisotopic Mass | 177.10224 |
| SMILES | C[N+]1=C(c2ccc(O)nc2)CCC1 |
| InChI | InChI=1S/C10H12N2O/c1-12-6-2-3-9(12)8-4-5-10(13)11-7-8/h4-5,7H,2-3,6H2,1H3/p+1 |
| InChIKey | OPKBIPWQEOKATF-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas geniculata (ncbitaxon:1167641) | |||
| - | PubMed (24416227) | Strain: N1 | |
| - | PubMed (24416227) | Strain: N1 | |
| Ochrobactrum sp. (ncbitaxon:42190) | |||
| - | PubMed (25344232) | Strain: SJY1 | |
| - | PubMed (25344232) | Strain: SJY1 | |
| Agrobacterium tumefaciens (ncbitaxon:358) | |||
| - | PubMed (22466953) | Strain: S33 | |
| - | PubMed (22466953) | Strain: S33 |
| Roles Classification |
|---|
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxy-N-methylmyosmine (CHEBI:87460) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 6-hydroxy-N-methylmyosmine (CHEBI:87460) is a ammonium ion derivative (CHEBI:35274) |
| 6-hydroxy-N-methylmyosmine (CHEBI:87460) is a monohydroxypyridine (CHEBI:38182) |
| 6-hydroxy-N-methylmyosmine (CHEBI:87460) is a organic cation (CHEBI:25697) |
| 6-hydroxy-N-methylmyosmine (CHEBI:87460) is a pyrroline (CHEBI:23763) |
| IUPAC Name |
|---|
| 5-(6-hydroxypyridin-3-yl)-1-methyl-3,4-dihydro-2H-pyrrolium |
| UniProt Name | Source |
|---|---|
| 6-hydroxy-N-methylmyosmine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14077 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27655163 | Reaxys |
| Citations |
|---|