EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO4 |
| Net Charge | 0 |
| Average Mass | 147.130 |
| Monoisotopic Mass | 147.05316 |
| SMILES | COC(=O)C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H9NO4/c1-10-4(7)2-3(6)5(8)9/h3H,2,6H2,1H3,(H,8,9)/t3-/m1/s1 |
| InChIKey | SBRYFUVVWOMLLP-GSVOUGTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Synechocystis sp. (ncbitaxon:1148) | |||
| - | MetaboLights (MTBLS5) | Strain: PCC 6803 | |
| - | PubMed (18945936) | Strain: PCC 6803 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl γ-D-aspartate (CHEBI:87437) has role bacterial metabolite (CHEBI:76969) |
| methyl γ-D-aspartate (CHEBI:87437) is a D-aspartic acid derivative (CHEBI:83979) |
| methyl γ-D-aspartate (CHEBI:87437) is a dicarboxylic acid monoester (CHEBI:36244) |
| IUPAC Name |
|---|
| (2R)-2-amino-4-methoxy-4-oxobutanoic acid |
| Synonym | Source |
|---|---|
| (R)-2-amino-4-methoxy-4-oxobutanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4664206 | Reaxys |