EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18O2 |
| Net Charge | 0 |
| Average Mass | 158.241 |
| Monoisotopic Mass | 158.13068 |
| SMILES | CCCCCCCC(=O)OC |
| InChI | InChI=1S/C9H18O2/c1-3-4-5-6-7-8-9(10)11-2/h3-8H2,1-2H3 |
| InChIKey | JGHZJRVDZXSNKQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl octanoate (CHEBI:87432) has role metabolite (CHEBI:25212) |
| methyl octanoate (CHEBI:87432) is a fatty acid methyl ester (CHEBI:4986) |
| methyl octanoate (CHEBI:87432) is a octanoate ester (CHEBI:87657) |
| Incoming Relation(s) |
| methyl 8-(tetracyclo[6.4.0.02,7.03,6]dodec-10-yl)octanoate (CHEBI:132947) has functional parent methyl octanoate (CHEBI:87432) |
| IUPAC Name |
|---|
| methyl octanoate |
| Synonyms | Source |
|---|---|
| octanoic acid methyl ester | ChEBI |
| caprylic acid methyl ester | ChEBI |
| methyl caprylate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031291 | HMDB |