EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87430 - ethyl decanoate
| Formula | C12H24O2 |
| Net Charge | 0 |
| Average Mass | 200.322 |
| Monoisotopic Mass | 200.17763 |
| SMILES | CCCCCCCCCC(=O)OCC |
| InChI | InChI=1S/C12H24O2/c1-3-5-6-7-8-9-10-11-12(13)14-4-2/h3-11H2,1-2H3 |
| InChIKey | RGXWDWUGBIJHDO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl decanoate (CHEBI:87430) has role metabolite (CHEBI:25212) |
| ethyl decanoate (CHEBI:87430) is a decanoate ester (CHEBI:87658) |
| ethyl decanoate (CHEBI:87430) is a fatty acid ethyl ester (CHEBI:78206) |
| IUPAC Name |
|---|
| ethyl decanoate |
| Synonyms | Source |
|---|---|
| decanoic acid ethyl ester | ChEBI |
| capric acid ethyl ester | ChEBI |
| ethyl caprate | ChEBI |
| Citations |
|---|