EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O2 |
| Net Charge | 0 |
| Average Mass | 144.214 |
| Monoisotopic Mass | 144.11503 |
| SMILES | CCCCOC(=O)CCC |
| InChI | InChI=1S/C8H16O2/c1-3-5-7-10-8(9)6-4-2/h3-7H2,1-2H3 |
| InChIKey | XUPYJHCZDLZNFP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butyl butanoate (CHEBI:87429) has functional parent butan-1-ol (CHEBI:28885) |
| butyl butanoate (CHEBI:87429) has role metabolite (CHEBI:25212) |
| butyl butanoate (CHEBI:87429) is a butyrate ester (CHEBI:50477) |
| IUPAC Name |
|---|
| butyl butanoate |
| Synonyms | Source |
|---|---|
| n-butyric n-butyl ester | ChemIDplus |
| n-butyl butanoate | ChEBI |
| n-butyl butyrate | ChEBI |
| UniProt Name | Source |
|---|---|
| butyl butanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039620 | HMDB |
| Butyl_butyrate | Wikipedia |
| Citations |
|---|