EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O3 |
| Net Charge | 0 |
| Average Mass | 258.402 |
| Monoisotopic Mass | 258.21949 |
| SMILES | CCCCCCCCCCC(O)CC(=O)OCC |
| InChI | InChI=1S/C15H30O3/c1-3-5-6-7-8-9-10-11-12-14(16)13-15(17)18-4-2/h14,16H,3-13H2,1-2H3 |
| InChIKey | LOFDGMSAUOHYLH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl 3-hydroxytridecanoate (CHEBI:87428) has role metabolite (CHEBI:25212) |
| ethyl 3-hydroxytridecanoate (CHEBI:87428) is a long-chain fatty acid ethyl ester (CHEBI:13209) |
| IUPAC Name |
|---|
| ethyl 3-hydroxytridecanoate |
| Synonym | Source |
|---|---|
| 3-hydroxy-tridecanoic acid ethyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059866 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1783172 | Reaxys |