EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H28O2 |
| Net Charge | 0 |
| Average Mass | 228.376 |
| Monoisotopic Mass | 228.20893 |
| SMILES | CCCCCCCCCCCC(=O)OCC |
| InChI | InChI=1S/C14H28O2/c1-3-5-6-7-8-9-10-11-12-13-14(15)16-4-2/h3-13H2,1-2H3 |
| InChIKey | MMXKVMNBHPAILY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl laurate (CHEBI:87427) has role metabolite (CHEBI:25212) |
| ethyl laurate (CHEBI:87427) is a fatty acid ethyl ester (CHEBI:78206) |
| IUPAC Name |
|---|
| ethyl dodecanoate |
| Synonyms | Source |
|---|---|
| dodecanoic acid ethyl ester | ChEBI |
| Ethyl laurinate | ChemIDplus |
| lauric acid ethyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033788 | HMDB |