EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O2 |
| Net Charge | 0 |
| Average Mass | 142.198 |
| Monoisotopic Mass | 142.09938 |
| SMILES | CCCCC1COC(=O)C1 |
| InChI | InChI=1S/C8H14O2/c1-2-3-4-7-5-8(9)10-6-7/h7H,2-6H2,1H3 |
| InChIKey | WJPRNDJHASWDLE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-butyl-γ-butyrolactone (CHEBI:87416) has functional parent γ-butyrolactone (CHEBI:42639) |
| 4-butyl-γ-butyrolactone (CHEBI:87416) has role metabolite (CHEBI:25212) |
| 4-butyl-γ-butyrolactone (CHEBI:87416) is a butan-4-olide (CHEBI:22950) |
| IUPAC Name |
|---|
| 4-butyloxolan-2-one |
| Synonyms | Source |
|---|---|
| 4-butyldihydrofuran-2(3H)-one | ChEBI |
| 4-octanolide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1562185 | Reaxys |