EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6ClNO2 |
| Net Charge | 0 |
| Average Mass | 171.583 |
| Monoisotopic Mass | 171.00871 |
| SMILES | O=[N+]([O-])c1ccc(CCl)cc1 |
| InChI | InChI=1S/C7H6ClNO2/c8-5-6-1-3-7(4-2-6)9(10)11/h1-4H,5H2 |
| InChIKey | KGCNHWXDPDPSBV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-nitrobenzyl chloride (CHEBI:87406) has role mutagen (CHEBI:25435) |
| p-nitrobenzyl chloride (CHEBI:87406) is a C-nitro compound (CHEBI:35716) |
| p-nitrobenzyl chloride (CHEBI:87406) is a benzyl chlorides (CHEBI:59852) |
| IUPAC Name |
|---|
| 1-(chloromethyl)-4-nitrobenzene |
| Synonyms | Source |
|---|---|
| 4-(chloromethyl)nitrobenzene | ChemIDplus |
| 4-nitrobenzyl chloride | ChemIDplus |
| p-(chloromethyl)nitrobenzene | NIST Chemistry WebBook |
| α-chloro-4-nitrotoluene | NIST Chemistry WebBook |
| α-chloro-p-nitrotoluene | NIST Chemistry WebBook |
| Citations |
|---|