EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O3 |
| Net Charge | 0 |
| Average Mass | 156.181 |
| Monoisotopic Mass | 156.07864 |
| SMILES | O=C(O)C[C@H]1CCCC(=O)C1 |
| InChI | InChI=1S/C8H12O3/c9-7-3-1-2-6(4-7)5-8(10)11/h6H,1-5H2,(H,10,11)/t6-/m0/s1 |
| InChIKey | RYTWPAUCABOYJP-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nostoc sp. (ncbitaxon:103690) | - | PubMed (17198383) | Strain: PCC 7120 |
| Rhodococcus sp. (ncbitaxon:157732) | - | PubMed (17198383) | Strain: NCIMB 9784 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(S)-3-oxocyclohexyl]acetic acid (CHEBI:87405) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| [(S)-3-oxocyclohexyl]acetic acid (CHEBI:87405) is a alicyclic ketone (CHEBI:36132) |
| [(S)-3-oxocyclohexyl]acetic acid (CHEBI:87405) is a oxo monocarboxylic acid (CHEBI:35871) |
| IUPAC Name |
|---|
| [(1S)-3-oxocyclohexyl]acetic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7526225 | Reaxys |
| Citations |
|---|