EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H68N10O14S2 |
| Net Charge | 0 |
| Average Mass | 1169.350 |
| Monoisotopic Mass | 1168.43579 |
| SMILES | [H][C@@]12C(=O)N(C)[C@]3(C[C@@H]3C)C(=O)OC[C@@H](NC(=O)c3nc4ccccc4cc3O)C(=O)N[C@@H](C)C(=O)N(C)[C@@H](CS[C@H]1SC(C)CC)C(=O)N(C)[C@]1(C[C@@H]1C)C(=O)OC[C@@H](NC(=O)c1nc3ccccc3cc1O)C(=O)N[C@@H](C)C(=O)N2C |
| InChI | InChI=1S/C56H68N10O14S2/c1-11-29(4)82-52-43-51(76)66(10)56(23-28(56)3)54(78)80-25-36(61-46(71)41-39(67)20-32-16-12-14-18-34(32)59-41)44(69)57-30(5)48(73)63(7)38(26-81-52)50(75)65(9)55(22-27(55)2)53(77)79-24-37(45(70)58-31(6)49(74)64(43)8)62-47(72)42-40(68)21-33-17-13-15-19-35(33)60-42/h12-21,27-31,36-38,43,52,67-68H,11,22-26H2,1-10H3,(H,57,69)(H,58,70)(H,61,71)(H,62,72)/t27-,28-,29?,30-,31-,36+,37+,38-,43+,52-,55-,56-/m0/s1 |
| InChIKey | VABRZWDEEDQLRD-VGGJGGOJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UK 63052 (CHEBI:87401) has role bacterial metabolite (CHEBI:76969) |
| UK 63052 (CHEBI:87401) is a cyclodepsipeptide (CHEBI:35213) |
| UK 63052 (CHEBI:87401) is a dithioacetal (CHEBI:59794) |
| UK 63052 (CHEBI:87401) is a heterodetic cyclic peptide (CHEBI:24533) |
| UK 63052 (CHEBI:87401) is a hydroxyquinoline (CHEBI:38774) |
| UK 63052 (CHEBI:87401) is a peptide antibiotic (CHEBI:25903) |
| IUPAC Name |
|---|
| N,N'-{(1S,1'R,2S,2''S,8'R,11'S,14'R,17'S,21'R,24'S,27'S)-27'-[(butan-2-yl)sulfanyl]-2,2'',3',11',13',16',24',26'-octamethyl-2',5',9',12',15',18',22',25'-octaoxo-6',19'-dioxa-28'-thia-3',10',13',16',23',26'-hexaazadispiro[cyclopropane-1,4'-bicyclo[12.12.3]nonacosane-17',1''-cyclopropane]-8',21'-diyl}bis(3-hydroxyquinoline-2-carboxamide) |
| Synonyms | Source |
|---|---|
| Antibiotic UK 63052 | ChemIDplus |
| SW-163G | ChEBI |
| UK 63,052 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11250492 | Reaxys |
| CAS:120763-23-7 | ChemIDplus |
| Citations |
|---|