EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H66N10O14S2 |
| Net Charge | 0 |
| Average Mass | 1155.323 |
| Monoisotopic Mass | 1154.42014 |
| SMILES | [H][C@@]12C(=O)N(C)[C@]3(C[C@@H]3C)C(=O)OC[C@@H](NC(=O)c3nc4ccccc4cc3O)C(=O)N[C@@H](C)C(=O)N(C)[C@@H](CS[C@H]1SC(C)C)C(=O)N(C)[C@]1(C[C@@H]1C)C(=O)OC[C@@H](NC(=O)c1nc3ccccc3cc1O)C(=O)N[C@@H](C)C(=O)N2C |
| InChI | InChI=1S/C55H66N10O14S2/c1-26(2)81-51-42-50(75)65(10)55(22-28(55)4)53(77)79-24-35(60-45(70)40-38(66)19-31-15-11-13-17-33(31)58-40)43(68)56-29(5)47(72)62(7)37(25-80-51)49(74)64(9)54(21-27(54)3)52(76)78-23-36(44(69)57-30(6)48(73)63(42)8)61-46(71)41-39(67)20-32-16-12-14-18-34(32)59-41/h11-20,26-30,35-37,42,51,66-67H,21-25H2,1-10H3,(H,56,68)(H,57,69)(H,60,70)(H,61,71)/t27-,28-,29-,30-,35+,36+,37-,42+,51-,54-,55-/m0/s1 |
| InChIKey | HDMUZLQWDPUHND-PGKBBLNOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. SNA15896 (ncbitaxon:497689) | - | PubMed (19514719) | Strain: SNA15896 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UK 65662 (CHEBI:87400) has role bacterial metabolite (CHEBI:76969) |
| UK 65662 (CHEBI:87400) is a cyclodepsipeptide (CHEBI:35213) |
| UK 65662 (CHEBI:87400) is a dithioacetal (CHEBI:59794) |
| UK 65662 (CHEBI:87400) is a heterodetic cyclic peptide (CHEBI:24533) |
| UK 65662 (CHEBI:87400) is a hydroxyquinoline (CHEBI:38774) |
| UK 65662 (CHEBI:87400) is a peptide antibiotic (CHEBI:25903) |
| IUPAC Name |
|---|
| N,N'-{(1S,1'R,2S,2''S,8'R,11'S,14'R,17'S,21'R,24'S,27'S)-2,2'',3',11',13',16',24',26'-octamethyl-2',5',9',12',15',18',22',25'-octaoxo-27'-[(propan-2-yl)sulfanyl]-6',19'-dioxa-28'-thia-3',10',13',16',23',26'-hexaazadispiro[cyclopropane-1,4'-bicyclo[12.12.3]nonacosane-17',1''-cyclopropane]-8',21'-diyl}bis(3-hydroxyquinoline-2-carboxamide) |
| Synonyms | Source |
|---|---|
| SW-163F | ChEBI |
| UK-65662 | ChemIDplus |
| UK 66,652 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11250491 | Reaxys |
| CAS:120832-02-2 | ChemIDplus |
| Citations |
|---|