EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O2 |
| Net Charge | 0 |
| Average Mass | 172.268 |
| Monoisotopic Mass | 172.14633 |
| SMILES | CCCCC(CC)COC(C)=O |
| InChI | InChI=1S/C10H20O2/c1-4-6-7-10(5-2)8-12-9(3)11/h10H,4-8H2,1-3H3 |
| InChIKey | WOYWLLHHWAMFCB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethylhexyl acetate (CHEBI:87392) has functional parent hexan-1-ol (CHEBI:87393) |
| 2-ethylhexyl acetate (CHEBI:87392) has role metabolite (CHEBI:25212) |
| 2-ethylhexyl acetate (CHEBI:87392) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| 2-ethylhexyl acetate |
| Synonyms | Source |
|---|---|
| 2-Ethyl-1-hexanol acetate | ChemIDplus |
| 2-Ethylhexanyl acetate | ChemIDplus |
| 2-Ethylhexyl ethanoate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1758321 | Reaxys |
| CAS:103-09-3 | ChemIDplus |