EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | CC(=O)CCOC(C)=O |
| InChI | InChI=1S/C6H10O3/c1-5(7)3-4-9-6(2)8/h3-4H2,1-2H3 |
| InChIKey | NWCYECXHIYEBJE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxobutyl acetate (CHEBI:87390) has functional parent butyl acetate (CHEBI:31328) |
| 3-oxobutyl acetate (CHEBI:87390) has role metabolite (CHEBI:25212) |
| 3-oxobutyl acetate (CHEBI:87390) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| 3-oxobutyl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1754095 | Reaxys |