EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H15O9S |
| Net Charge | -3 |
| Average Mass | 467.431 |
| Monoisotopic Mass | 467.04532 |
| SMILES | CC1=C/C(=C(/c2cc(C)c(O)c(C(=O)[O-])c2)c2ccccc2S(=O)(=O)[O-])C=C(C(=O)[O-])C1=O |
| InChI | InChI=1S/C23H18O9S/c1-11-7-13(9-16(20(11)24)22(26)27)19(15-5-3-4-6-18(15)33(30,31)32)14-8-12(2)21(25)17(10-14)23(28)29/h3-10,24H,1-2H3,(H,26,27)(H,28,29)(H,30,31,32)/p-3/b19-14+ |
| InChIKey | KXOWVZNVTQLQPD-XMHGGMMESA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chromoxane cyanin R(3−) (CHEBI:87387) is a hydroxybenzoate (CHEBI:24675) |
| chromoxane cyanin R(3−) (CHEBI:87387) is a organosulfonate oxoanion (CHEBI:33554) |
| chromoxane cyanin R(3−) (CHEBI:87387) is conjugate base of chromoxane cyanin R free acid (CHEBI:87389) |
| Incoming Relation(s) |
| chromoxane cyanin R (CHEBI:87376) has part chromoxane cyanin R(3−) (CHEBI:87387) |
| chromoxane cyanin R free acid (CHEBI:87389) is conjugate acid of chromoxane cyanin R(3−) (CHEBI:87387) |
| IUPAC Name |
|---|
| 5-[(3-carboxylato-5-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)(2-sulfonatophenyl)methyl]-2-hydroxy-3-methylbenzoate |
| Synonyms | Source |
|---|---|
| chromoxane cyanin R trianion | ChEBI |
| chromoxane cyanin R anion | ChEBI |