EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10O6 |
| Net Charge | 0 |
| Average Mass | 238.195 |
| Monoisotopic Mass | 238.04774 |
| SMILES | COC(=O)c1ccc(C(=O)O)cc1C(=O)OC |
| InChI | InChI=1S/C11H10O6/c1-16-10(14)7-4-3-6(9(12)13)5-8(7)11(15)17-2/h3-5H,1-2H3,(H,12,13) |
| InChIKey | KUQGJFOIULVBKJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-bis(methoxycarbonyl)benzoic acid (CHEBI:87385) has role metabolite (CHEBI:25212) |
| 3,4-bis(methoxycarbonyl)benzoic acid (CHEBI:87385) is a benzoate ester (CHEBI:36054) |
| 3,4-bis(methoxycarbonyl)benzoic acid (CHEBI:87385) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 3,4-bis(methoxycarbonyl)benzoic acid |
| Synonym | Source |
|---|---|
| benzene-1,2,4-tricarboxylic acid-1,2-dimethyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 530275 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3354589 | Reaxys |