EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16 |
| Net Charge | 0 |
| Average Mass | 196.293 |
| Monoisotopic Mass | 196.12520 |
| SMILES | CC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16/c1-13(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14/h2-11,13H,12H2,1H3 |
| InChIKey | XLWCIHPMASUXPI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1'-(propane-1,2-diyl)dibenzene (CHEBI:87382) has parent hydride 1,2-dihydrostilbene (CHEBI:34047) |
| 1,1'-(propane-1,2-diyl)dibenzene (CHEBI:87382) has role metabolite (CHEBI:25212) |
| 1,1'-(propane-1,2-diyl)dibenzene (CHEBI:87382) is a diphenylethane (CHEBI:51571) |
| IUPAC Name |
|---|
| 1,1'-(propane-1,2-diyl)dibenzene |
| Synonyms | Source |
|---|---|
| 1,1'-(1-methyl-1,2-ethanediyl)bisbenzene | ChEBI |
| (1-phenylpropan-2-yl)benzene | ChEBI |
| α-methylbibenzyl | ChEBI |