EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24O2 |
| Net Charge | 0 |
| Average Mass | 200.322 |
| Monoisotopic Mass | 200.17763 |
| SMILES | CCCCCCCC(=O)OCCCC |
| InChI | InChI=1S/C12H24O2/c1-3-5-7-8-9-10-12(13)14-11-6-4-2/h3-11H2,1-2H3 |
| InChIKey | PSXNDMJWRZYVTM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butyl octanoate (CHEBI:87380) has functional parent butan-1-ol (CHEBI:28885) |
| butyl octanoate (CHEBI:87380) has role metabolite (CHEBI:25212) |
| butyl octanoate (CHEBI:87380) is a octanoate ester (CHEBI:87657) |
| IUPAC Name |
|---|
| butyl octanoate |
| Synonyms | Source |
|---|---|
| Butyl caprylate | ChemIDplus |
| n-Butylcaprylate | ChemIDplus |
| n-Butyl octanoate | ChemIDplus |
| Citations |
|---|