EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87379 - 3-methyl-1-butyne
| Formula | C5H8 |
| Net Charge | 0 |
| Average Mass | 68.119 |
| Monoisotopic Mass | 68.06260 |
| SMILES | C#CC(C)C |
| InChI | InChI=1S/C5H8/c1-4-5(2)3/h1,5H,2-3H3 |
| InChIKey | USCSRAJGJYMJFZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-1-butyne (CHEBI:87379) has parent hydride but-1-yne (CHEBI:48087) |
| 3-methyl-1-butyne (CHEBI:87379) has role metabolite (CHEBI:25212) |
| 3-methyl-1-butyne (CHEBI:87379) is a alkyne (CHEBI:22339) |
| 3-methyl-1-butyne (CHEBI:87379) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| 3-methylbut-1-yne |
| Synonym | Source |
|---|---|
| isopropyl acetylene | ChEBI |