EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O2 |
| Net Charge | 0 |
| Average Mass | 240.387 |
| Monoisotopic Mass | 240.20893 |
| SMILES | O=C(O)CCCCCCCCCC1CCCC1 |
| InChI | InChI=1S/C15H28O2/c16-15(17)13-7-5-3-1-2-4-6-10-14-11-8-9-12-14/h14H,1-13H2,(H,16,17) |
| InChIKey | XMKHJDJISUCUGF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-cyclopentylundecanoic acid (CHEBI:87377) has role metabolite (CHEBI:25212) |
| 11-cyclopentylundecanoic acid (CHEBI:87377) is a carbocyclic fatty acid (CHEBI:35744) |
| IUPAC Name |
|---|
| 10-cyclopentyldecanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1952226 | Reaxys |