EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:87373 - pentyl propanoate
| Formula | C8H16O2 |
| Net Charge | 0 |
| Average Mass | 144.214 |
| Monoisotopic Mass | 144.11503 |
| SMILES | CCCCCOC(=O)CC |
| InChI | InChI=1S/C8H16O2/c1-3-5-6-7-10-8(9)4-2/h3-7H2,1-2H3 |
| InChIKey | TWSRVQVEYJNFKQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentyl propanoate (CHEBI:87373) has functional parent pentan-1-ol (CHEBI:44884) |
| pentyl propanoate (CHEBI:87373) has role fungal metabolite (CHEBI:76946) |
| pentyl propanoate (CHEBI:87373) is a propanoate ester (CHEBI:36243) |
| IUPAC Name |
|---|
| pentyl propanoate |
| Synonyms | Source |
|---|---|
| amyl propionate | ChEBI |
| propionic acid pentyl ester | ChEBI |
| n-pentyl propionate | ChEBI |
| UniProt Name | Source |
|---|---|
| pentyl propanoate | UniProt |
| Citations |
|---|